Name | 4-methoxy-3-methyl-5-[(2r,3s,4z,6r)-3-methyl-5-oxa-10-azatricyclo[8.3.0.0²,⁶]trideca-1(13),11-dien-4-ylidene]furan-2-one |
Wikidata | Q105004325 |
Mol. formula | C18H21NO4 |
CAS registry number | - |
Mol. weight | 315.3643 |
Temporary LOTUS id | LTS0100856 |
Name | 4-methoxy-3-methyl-5-[(2r,3s,4z,6r)-3-methyl-5-oxa-10-azatricyclo[8.3.0.0²,⁶]trideca-1(13),11-dien-4-ylidene]furan-2-one |
Canonical SMILES | COC1=C(C)C(=O)O/C1=C1\O[C@@H]2CCCn3cccc3[C@H]2[C@@H]1C |
2D SMILES | COC1=C(C)C(=O)OC1=C1OC2CCCn3cccc3C2C1C |
IUPAC name | 4-methoxy-3-methyl-5-[(2R,3S,4Z,6R)-3-methyl-5-oxa-10-azatricyclo[8.3.0.0²,⁶]trideca-1(13),11-dien-4-ylidene]-2,5-dihydrofuran-2-one |
InChI | InChI=1S/C18H21NO4/c1-10-14-12-6-4-8-19(12)9-5-7-13(14)22-16(10)17-15(21-3)11(2)18(20)23-17/h4,6,8,10,13-14H,5,7,9H2,1-3H3/b17-16-/t10-,13+,14+/m0/s1 |
InChIKey | FXVHTRMDTUSKQV-GZOOZXGESA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C(C=CC1)=C2OC3CCCn4cccc4C3C2 |
Pathway | Superclass | Class |
Alkaloids | Ornithine alkaloids | Stemona alkaloids |
Total atom number | 44 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.06 |
Alogp | 2.01 |
Alogp2 | 4.03 |
Apol | 49.9907 |
Bpol | 31.6433 |
EccentricConnectivityIndexDescriptor | 371 |
FmfDescriptor | 0.7826 |
Fsp3 | 0.5 |
FragmentComplexityDescriptor | 1703.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1074 |
Xlogp | 3.784 |
ZagrebIndex | 130 |
TopoPSA | 49.69 |