Name | [(1r,2e,8r,10r,11s)-8,10,11-trihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.0³,⁷]tetradeca-2,6-dien-6-yl]methyl 2-methylprop-2-enoate |
Wikidata | Q105341937 |
Mol. formula | C19H24O8 |
CAS registry number | - |
Mol. weight | 380.3898 |
Temporary LOTUS id | LTS0100214 |
Name | [(1r,2e,8r,10r,11s)-8,10,11-trihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.0³,⁷]tetradeca-2,6-dien-6-yl]methyl 2-methylprop-2-enoate |
Canonical SMILES | C=C(C)C(=O)OCC1=C2/C(=C\[C@@]3(C)CC[C@](O)(O3)[C@](C)(O)C[C@H]2O)OC1=O |
2D SMILES | C=C(C)C(=O)OCC1=C2C(=CC3(C)CCC(O)(O3)C(C)(O)CC2O)OC1=O |
IUPAC name | [(1R,2E,8R,10R,11S)-8,10,11-trihydroxy-1,10-dimethyl-5-oxo-4,14-dioxatricyclo[9.2.1.0³,⁷]tetradeca-2,6-dien-6-yl]methyl 2-methylprop-2-enoate |
InChI | InChI=1S/C19H24O8/c1-10(2)15(21)25-9-11-14-12(20)7-18(4,23)19(24)6-5-17(3,27-19)8-13(14)26-16(11)22/h8,12,20,23-24H,1,5-7,9H2,2-4H3/b13-8+/t12-,17-,18-,19+/m1/s1 |
InChIKey | XTUQPQRJSZRSDZ-VPKOSVKTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C2=CC3OC(CCCC2=CC1)CC3 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 51 |
Heavy atom number | 27 |
Bond count | 29 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.37 |
Alogp | 0.27 |
Alogp2 | 0.07 |
Apol | 55.859 |
Bpol | 33.901 |
EccentricConnectivityIndexDescriptor | 495 |
FmfDescriptor | 0.5185 |
Fsp3 | 0.5789 |
FragmentComplexityDescriptor | 2107.08 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1672 |
Xlogp | 0.573 |
ZagrebIndex | 152 |
TopoPSA | 122.52 |