Name | 1-hydroxy-3,5-bis(4-hydroxyphenyl)pent-4-en-2-one |
Wikidata | Q105238250 |
Mol. formula | C17H16O4 |
CAS registry number | - |
Mol. weight | 284.3072 |
Temporary LOTUS id | LTS0100034 |
Name | 1-hydroxy-3,5-bis(4-hydroxyphenyl)pent-4-en-2-one |
Canonical SMILES | O=C(CO)C(C=Cc1ccc(O)cc1)c1ccc(O)cc1 |
2D SMILES | O=C(CO)C(C=Cc1ccc(O)cc1)c1ccc(O)cc1 |
IUPAC name | 1-hydroxy-3,5-bis(4-hydroxyphenyl)pent-4-en-2-one |
InChI | InChI=1S/C17H16O4/c18-11-17(21)16(13-4-8-15(20)9-5-13)10-3-12-1-6-14(19)7-2-12/h1-10,16,18-20H,11H2 |
InChIKey | RJZJWQWXSFCNEG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3)| | | |
Total atom number | 37 |
Heavy atom number | 21 |
Bond count | 22 |
Number of carbons | 17 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.02 |
Alogp | 2.42 |
Alogp2 | 5.88 |
Apol | 43.7967 |
Bpol | 18.4493 |
EccentricConnectivityIndexDescriptor | 398 |
FmfDescriptor | 0.7143 |
Fsp3 | 0.1176 |
FragmentComplexityDescriptor | 1024.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1002 |
Xlogp | 2.345 |
ZagrebIndex | 102 |
TopoPSA | 77.76 |