Name | 2-(4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2h-naphthalen-2-yl)propan-2-ol |
Wikidata | Q67880166 |
Mol. formula | C15H26O |
CAS registry number | - |
Mol. weight | 222.3669 |
Temporary LOTUS id | LTS0099428 |
Name | 2-(4a,8-dimethyl-3,4,5,6,7,8-hexahydro-2h-naphthalen-2-yl)propan-2-ol |
Canonical SMILES | CC1CCCC2(C)CCC(C(C)(C)O)C=C12 |
2D SMILES | CC1CCCC2(C)CCC(C(C)(C)O)C=C12 |
IUPAC name | 2-(4a,8-dimethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-yl)propan-2-ol |
InChI | InChI=1S/C15H26O/c1-11-6-5-8-15(4)9-7-12(10-13(11)15)14(2,3)16/h10-12,16H,5-9H2,1-4H3 |
InChIKey | SRHDLIDOZXPROB-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CCCCC2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Eudesmane sesquiterpenoids |
Total atom number | 42 |
Heavy atom number | 16 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.41 |
Alogp | 3.67 |
Alogp2 | 13.44 |
Apol | 44.5386 |
Bpol | 28.4234 |
EccentricConnectivityIndexDescriptor | 183 |
FmfDescriptor | 0.625 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1609.01 |
PetitjeanNumber | 0.4286 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 396 |
Xlogp | 4.478 |
ZagrebIndex | 88 |
TopoPSA | 20.23 |