Name | Bicyclogermacrene |
Wikidata | Q27132747 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0099340 |
Name | Bicyclogermacrene |
Canonical SMILES | C/C1=C\[C@H]2[C@@H](CC/C(C)=C/CC1)C2(C)C |
2D SMILES | CC1=CC2C(CCC(C)=CCC1)C2(C)C |
IUPAC name | (1S,2E,6E,10R)-3,7,11,11-tetramethylbicyclo[8.1.0]undeca-2,6-diene |
InChI | InChI=1S/C15H24/c1-11-6-5-7-12(2)10-14-13(9-8-11)15(14,3)4/h6,10,13-14H,5,7-9H2,1-4H3/b11-6+,12-10+/t13-,14+/m1/s1 |
InChIKey | VPDZRSSKICPUEY-JEPMYXAXSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CCCC2CC2C=CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bicyclogermacrane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 16 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 4.7 |
Alogp2 | 22.08 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 172 |
FmfDescriptor | 0.7333 |
Fsp3 | 0.7333 |
FragmentComplexityDescriptor | 1390 |
PetitjeanNumber | 0.1667 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 346 |
Xlogp | 5.999 |
ZagrebIndex | 80 |
TopoPSA | 0 |