Name | 4',7-flavandiol |
Wikidata | Q105367831 |
Mol. formula | C15H14O3 |
CAS registry number | - |
Mol. weight | 242.2704 |
Temporary LOTUS id | LTS0098894 |
Name | 4',7-flavandiol |
Canonical SMILES | Oc1ccc(C2CCc3ccc(O)cc3O2)cc1 |
2D SMILES | Oc1ccc(C2CCc3ccc(O)cc3O2)cc1 |
IUPAC name | 2-(4-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-7-ol |
InChI | InChI=1S/C15H14O3/c16-12-5-1-10(2-6-12)14-8-4-11-3-7-13(17)9-15(11)18-14/h1-3,5-7,9,14,16-17H,4,8H2 |
InChIKey | YXMLGIGHGPSEKA-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CCC1c3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavans |
Total atom number | 32 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 3.42 |
Alogp2 | 11.71 |
Apol | 38.1411 |
Bpol | 17.2209 |
EccentricConnectivityIndexDescriptor | 304 |
FmfDescriptor | 0.8889 |
Fsp3 | 0.2 |
FragmentComplexityDescriptor | 850.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 616 |
Xlogp | 3.142 |
ZagrebIndex | 96 |
TopoPSA | 49.69 |