Name | 1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,3b,6,6,9a-pentamethyl-dodecahydrocyclopenta[a]phenanthren-7-one |
Wikidata | Q105180152 |
Mol. formula | C30H50O2 |
CAS registry number | - |
Mol. weight | 442.7179 |
Temporary LOTUS id | LTS0098475 |
Name | 1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,3b,6,6,9a-pentamethyl-dodecahydrocyclopenta[a]phenanthren-7-one |
Canonical SMILES | CC(C)=CCCC(C)(O)C1CCC2(C)C1CCC1C3(C)CCC(=O)C(C)(C)C3CCC12C |
2D SMILES | CC(C)=CCCC(C)(O)C1CCC2(C)C1CCC1C3(C)CCC(=O)C(C)(C)C3CCC12C |
IUPAC name | 1-(2-hydroxy-6-methylhept-5-en-2-yl)-3a,3b,6,6,9a-pentamethyl-hexadecahydro-1H-cyclopenta[a]phenanthren-7-one |
InChI | InChI=1S/C30H50O2/c1-20(2)10-9-16-30(8,32)22-13-18-28(6)21(22)11-12-24-27(5)17-15-25(31)26(3,4)23(27)14-19-29(24,28)7/h10,21-24,32H,9,11-19H2,1-8H3 |
InChIKey | NJICGAVMYWKCMW-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2C(C1)CCC3C4CCCC4CCC23 |
Pathway | Superclass | Class |
Terpenoids | Triterpenoids | Dammarane and Protostane triterpenoids |
Total atom number | 82 |
Heavy atom number | 32 |
Bond count | 35 |
Number of carbons | 30 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.22 |
Alogp | 6.92 |
Alogp2 | 47.88 |
Apol | 87.7436 |
Bpol | 55.6183 |
EccentricConnectivityIndexDescriptor | 763 |
FmfDescriptor | 0.5313 |
Fsp3 | 0.9 |
FragmentComplexityDescriptor | 6233.02 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2716 |
Xlogp | 9.23 |
ZagrebIndex | 188 |
TopoPSA | 37.3 |