Name | 5,6,13-trimethoxy-2-oxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
Wikidata | Q102165948 |
Mol. formula | C18H18O4 |
CAS registry number | - |
Mol. weight | 298.3338 |
Temporary LOTUS id | LTS0098070 |
Name | 5,6,13-trimethoxy-2-oxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
Canonical SMILES | COc1cc2c3c(c1)OCc1c(OC)c(OC)cc(c1-3)CC2 |
2D SMILES | COc1cc2c3c(c1)OCc1c(OC)c(OC)cc(c1-3)CC2 |
IUPAC name | 5,6,13-trimethoxy-2-oxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(14),4,6,8(16),11(15),12-hexaene |
InChI | InChI=1S/C18H18O4/c1-19-12-6-10-4-5-11-7-15(20-2)18(21-3)13-9-22-14(8-12)17(10)16(11)13/h6-8H,4-5,9H2,1-3H3 |
InChIKey | WPALDSILAYYDIL-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cccc3c2-c4c(cccc4CC3)C1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenanthrenoids | Phenanthrenes |
Total atom number | 40 |
Heavy atom number | 22 |
Bond count | 25 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 3.64 |
Alogp2 | 13.23 |
Apol | 46.8903 |
Bpol | 27.3417 |
EccentricConnectivityIndexDescriptor | 386 |
FmfDescriptor | 0.7273 |
Fsp3 | 0.3333 |
FragmentComplexityDescriptor | 1387.04 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 925 |
Xlogp | 3.366 |
ZagrebIndex | 124 |
TopoPSA | 36.92 |