Name | (1r,4r,9s,12s,13r,15r)-12-hydroxy-15-isopropyl-8,8-dimethyl-2,14-dioxapentacyclo[10.5.0.0¹,⁴.0⁴,⁹.0¹³,¹⁵]heptadecan-3-one |
Wikidata | Q105241487 |
Mol. formula | C20H30O4 |
CAS registry number | - |
Mol. weight | 334.4506 |
Temporary LOTUS id | LTS0097227 |
Name | (1r,4r,9s,12s,13r,15r)-12-hydroxy-15-isopropyl-8,8-dimethyl-2,14-dioxapentacyclo[10.5.0.0¹,⁴.0⁴,⁹.0¹³,¹⁵]heptadecan-3-one |
Canonical SMILES | CC(C)[C@]12CC[C@@]34OC(=O)[C@@]35CCCC(C)(C)[C@@H]5CC[C@]4(O)[C@H]1O2 |
2D SMILES | CC(C)C12CCC34OC(=O)C35CCCC(C)(C)C5CCC4(O)C1O2 |
IUPAC name | (1R,4R,9S,12S,13R,15R)-12-hydroxy-8,8-dimethyl-15-(propan-2-yl)-2,14-dioxapentacyclo[10.5.0.0¹,⁴.0⁴,⁹.0¹³,¹⁵]heptadecan-3-one |
InChI | InChI=1S/C20H30O4/c1-12(2)18-10-11-20-17(15(21)24-20)8-5-7-16(3,4)13(17)6-9-19(20,22)14(18)23-18/h12-14,22H,5-11H2,1-4H3/t13-,14-,17-,18+,19-,20+/m0/s1 |
InChIKey | RNKHTKYLFIGYTD-IWUPOPMTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC23CCCCC3CCC4C5OC5CCC142 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Diterpenoids|Diterpenoids | Abietane diterpenoids|Abeoabietane diterpenoids |
Total atom number | 54 |
Heavy atom number | 24 |
Bond count | 28 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 17 |
NP-likeness score | 1.28 |
Alogp | 3.07 |
Alogp2 | 9.43 |
Apol | 58.4118 |
Bpol | 37.5862 |
EccentricConnectivityIndexDescriptor | 376 |
FmfDescriptor | 0.7083 |
Fsp3 | 0.95 |
FragmentComplexityDescriptor | 2812.04 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1068 |
Xlogp | 3.821 |
ZagrebIndex | 158 |
TopoPSA | 59.06 |