Name | 4',6-dimethylspiro[naphtho[1,2-c]furan-3,2'-oxolan]-1-one |
Wikidata | Q104395045 |
Mol. formula | C17H16O3 |
CAS registry number | - |
Mol. weight | 268.3078 |
Temporary LOTUS id | LTS0095231 |
Name | 4',6-dimethylspiro[naphtho[1,2-c]furan-3,2'-oxolan]-1-one |
Canonical SMILES | Cc1cccc2c3c(ccc12)C1(CC(C)CO1)OC3=O |
2D SMILES | Cc1cccc2c3c(ccc12)C1(CC(C)CO1)OC3=O |
IUPAC name | 4',6-dimethyl-1H-spiro[naphtho[1,2-c]furan-3,2'-oxolan]-1-one |
InChI | InChI=1S/C17H16O3/c1-10-8-17(19-9-10)14-7-6-12-11(2)4-3-5-13(12)15(14)16(18)20-17/h3-7,10H,8-9H2,1-2H3 |
InChIKey | DNLNYCCHXAULQA-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1Cc2c3ccccc3ccc2C14OCCC4 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Sesquiterpenoids| | | |
Total atom number | 36 |
Heavy atom number | 20 |
Bond count | 23 |
Number of carbons | 17 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 3.4 |
Alogp2 | 11.58 |
Apol | 42.9947 |
Bpol | 22.2813 |
EccentricConnectivityIndexDescriptor | 306 |
FmfDescriptor | 0.85 |
Fsp3 | 0.3529 |
FragmentComplexityDescriptor | 1141.03 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 705 |
Xlogp | 3.889 |
ZagrebIndex | 118 |
TopoPSA | 35.53 |