Name | 2-methyl-6-(4-methylcyclohexa-1,3-dien-1-yl)hept-2-en-1-yl 4-methylpentanoate |
Wikidata | Q105024281 |
Mol. formula | C21H34O2 |
CAS registry number | - |
Mol. weight | 318.4942 |
Temporary LOTUS id | LTS0094853 |
Name | 2-methyl-6-(4-methylcyclohexa-1,3-dien-1-yl)hept-2-en-1-yl 4-methylpentanoate |
Canonical SMILES | CC1=CC=C(C(C)CCC=C(C)COC(=O)CCC(C)C)CC1 |
2D SMILES | CC1=CC=C(C(C)CCC=C(C)COC(=O)CCC(C)C)CC1 |
IUPAC name | 2-methyl-6-(4-methylcyclohexa-1,3-dien-1-yl)hept-2-en-1-yl 4-methylpentanoate |
InChI | InChI=1S/C21H34O2/c1-16(2)9-14-21(22)23-15-18(4)7-6-8-19(5)20-12-10-17(3)11-13-20/h7,10,12,16,19H,6,8-9,11,13-15H2,1-5H3 |
InChIKey | GYZWFKRGEXLHOG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C=1C=CCCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bisabolane sesquiterpenoids |
Total atom number | 57 |
Heavy atom number | 23 |
Bond count | 23 |
Number of carbons | 21 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 6.39 |
Alogp2 | 40.89 |
Apol | 61.235 |
Bpol | 40.043 |
EccentricConnectivityIndexDescriptor | 563 |
FmfDescriptor | 0.2609 |
Fsp3 | 0.6667 |
FragmentComplexityDescriptor | 2743.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1576 |
Xlogp | 6.231 |
ZagrebIndex | 104 |
TopoPSA | 26.3 |