Name | Dimethyl anthranilate |
Wikidata | Q27263085 |
Mol. formula | C9H11NO2 |
CAS registry number | - |
Mol. weight | 165.1895 |
Temporary LOTUS id | LTS0093066 |
Name | Dimethyl anthranilate |
Canonical SMILES | CNc1ccccc1C(=O)OC |
2D SMILES | CNc1ccccc1C(=O)OC |
IUPAC name | methyl 2-(methylamino)benzoate |
InChI | InChI=1S/C9H11NO2/c1-10-8-6-4-3-5-7(8)9(11)12-2/h3-6,10H,1-2H3 |
InChIKey | GVOWHGSUZUUUDR-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Alkaloids | Anthranilic acid alkaloids | Anthranillic acid derivatives |
Total atom number | 23 |
Heavy atom number | 12 |
Bond count | 12 |
Number of carbons | 9 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 1.49 |
Alogp2 | 2.23 |
Apol | 25.8787 |
Bpol | 15.5593 |
EccentricConnectivityIndexDescriptor | 110 |
FmfDescriptor | 0.5 |
Fsp3 | 0.2222 |
FragmentComplexityDescriptor | 397.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 194 |
Xlogp | 2.033 |
ZagrebIndex | 54 |
TopoPSA | 38.33 |