Name | 2-(2-hydroxy-4,5-dimethoxyphenyl)-3,7,8-trimethoxychromen-4-one |
Wikidata | Q27137789 |
Mol. formula | C20H20O8 |
CAS registry number | - |
Mol. weight | 388.3688 |
Temporary LOTUS id | LTS0092409 |
Name | 2-(2-hydroxy-4,5-dimethoxyphenyl)-3,7,8-trimethoxychromen-4-one |
Canonical SMILES | COc1cc(O)c(-c2oc3c(OC)c(OC)ccc3c(=O)c2OC)cc1OC |
2D SMILES | COc1cc(O)c(-c2oc3c(OC)c(OC)ccc3c(=O)c2OC)cc1OC |
IUPAC name | 2-(2-hydroxy-4,5-dimethoxyphenyl)-3,7,8-trimethoxy-4H-chromen-4-one |
InChI | InChI=1S/C20H20O8/c1-23-13-7-6-10-16(22)20(27-5)18(28-17(10)19(13)26-4)11-8-14(24-2)15(25-3)9-12(11)21/h6-9,21H,1-5H3 |
InChIKey | ILFIBHRYVRDHNZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CC=C1c3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavonols |
Total atom number | 48 |
Heavy atom number | 28 |
Bond count | 30 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1 |
Alogp | 3.48 |
Alogp2 | 12.11 |
Apol | 54.9519 |
Bpol | 34.3181 |
EccentricConnectivityIndexDescriptor | 536 |
FmfDescriptor | 0.5714 |
Fsp3 | 0.25 |
FragmentComplexityDescriptor | 1744.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1863 |
Xlogp | 3.787 |
ZagrebIndex | 146 |
TopoPSA | 96.59 |