Name | 8,9-dihydroxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradecan-2-yl (2e)-2-methylbut-2-enoate |
Wikidata | Q82231752 |
Mol. formula | C20H28O7 |
CAS registry number | - |
Mol. weight | 380.4329 |
Temporary LOTUS id | LTS0091150 |
Name | 8,9-dihydroxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradecan-2-yl (2e)-2-methylbut-2-enoate |
Canonical SMILES | C=C1C(=O)OC2CC(C)(O)C(O)CC3OC3(C)CC(OC(=O)/C(C)=C/C)C12 |
2D SMILES | C=C1C(=O)OC2CC(C)(O)C(O)CC3OC3(C)CC(OC(=O)C(C)=CC)C12 |
IUPAC name | 8,9-dihydroxy-4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradecan-2-yl (2E)-2-methylbut-2-enoate |
InChI | InChI=1S/C20H28O7/c1-6-10(2)17(22)25-13-9-20(5)15(27-20)7-14(21)19(4,24)8-12-16(13)11(3)18(23)26-12/h6,12-16,21,24H,3,7-9H2,1-2,4-5H3/b10-6+ |
InChIKey | OFNWVOIJEOVYPP-UXBLZVDNSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC3OC3CCCCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 55 |
Heavy atom number | 27 |
Bond count | 29 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.21 |
Alogp | 0.98 |
Alogp2 | 0.95 |
Apol | 59.4842 |
Bpol | 38.2738 |
EccentricConnectivityIndexDescriptor | 469 |
FmfDescriptor | 0.5185 |
Fsp3 | 0.7 |
FragmentComplexityDescriptor | 2547.07 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1622 |
Xlogp | 1.763 |
ZagrebIndex | 150 |
TopoPSA | 105.59 |