Name | (5e)-1,7-bis(4-hydroxyphenyl)hept-5-en-3-one |
Wikidata | Q105378642 |
Mol. formula | C19H20O3 |
CAS registry number | - |
Mol. weight | 296.361 |
Temporary LOTUS id | LTS0090432 |
Name | (5e)-1,7-bis(4-hydroxyphenyl)hept-5-en-3-one |
Canonical SMILES | O=C(C/C=C/Cc1ccc(O)cc1)CCc1ccc(O)cc1 |
2D SMILES | O=C(CC=CCc1ccc(O)cc1)CCc1ccc(O)cc1 |
IUPAC name | (5E)-1,7-bis(4-hydroxyphenyl)hept-5-en-3-one |
InChI | InChI=1S/C19H20O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h1-2,5-6,8-9,11-14,21-22H,3-4,7,10H2/b2-1+ |
InChIKey | ZKPVOVWRYJTYRF-OWOJBTEDSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)CC=CCCCCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Diarylheptanoids | Linear diarylheptanoids |
Total atom number | 42 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.02 |
Alogp | 4 |
Alogp2 | 16 |
Apol | 49.1819 |
Bpol | 22.8221 |
EccentricConnectivityIndexDescriptor | 565 |
FmfDescriptor | 0.8636 |
Fsp3 | 0.2105 |
FragmentComplexityDescriptor | 1387.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1404 |
Xlogp | 3.769 |
ZagrebIndex | 104 |
TopoPSA | 57.53 |