Name | 4-(2h-1,3-benzodioxol-5-ylmethyl)-3-[(7-methoxy-2h-1,3-benzodioxol-5-yl)methyl]oxolan-2-ol |
Wikidata | Q105190529 |
Mol. formula | C21H22O7 |
CAS registry number | - |
Mol. weight | 386.396 |
Temporary LOTUS id | LTS0089117 |
Name | 4-(2h-1,3-benzodioxol-5-ylmethyl)-3-[(7-methoxy-2h-1,3-benzodioxol-5-yl)methyl]oxolan-2-ol |
Canonical SMILES | COc1cc(CC2C(Cc3ccc4c(c3)OCO4)COC2O)cc2c1OCO2 |
2D SMILES | COc1cc(CC2C(Cc3ccc4c(c3)OCO4)COC2O)cc2c1OCO2 |
IUPAC name | 4-[(2H-1,3-benzodioxol-5-yl)methyl]-3-[(7-methoxy-2H-1,3-benzodioxol-5-yl)methyl]oxolan-2-ol |
InChI | InChI=1S/C21H22O7/c1-23-18-7-13(8-19-20(18)28-11-27-19)5-15-14(9-24-21(15)22)4-12-2-3-16-17(6-12)26-10-25-16/h2-3,6-8,14-15,21-22H,4-5,9-11H2,1H3 |
InChIKey | OESUUVYVASHNOY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)CC3COCC3Cc4ccc5OCOc5c4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Lignans|Lignans | Furanoid lignans|Dibenzylbutyrolactone lignans |
Total atom number | 50 |
Heavy atom number | 28 |
Bond count | 32 |
Number of carbons | 21 |
Minimal number of rings | 5 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 3.18 |
Alogp2 | 10.1 |
Apol | 57.2434 |
Bpol | 35.5466 |
EccentricConnectivityIndexDescriptor | 655 |
FmfDescriptor | 0.8929 |
Fsp3 | 0.4286 |
FragmentComplexityDescriptor | 2160.07 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2121 |
Xlogp | 2.636 |
ZagrebIndex | 156 |
TopoPSA | 75.61 |