Name | 10-(acetyloxy)-2,4a,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydro-1h-picene-1-carboxylic acid |
Wikidata | Q104937219 |
Mol. formula | C32H50O4 |
CAS registry number | - |
Mol. weight | 498.7382 |
Temporary LOTUS id | LTS0088610 |
Name | 10-(acetyloxy)-2,4a,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,7,8,8a,10,11,12,12b,13,14b-tetradecahydro-1h-picene-1-carboxylic acid |
Canonical SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4C(C(=O)O)C(C)CCC4(C)CCC23C)C1(C)C |
2D SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4C(C(=O)O)C(C)CCC4(C)CCC23C)C1(C)C |
IUPAC name | 10-(acetyloxy)-2,4a,6a,6b,9,9,12a-heptamethyl-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-1-carboxylic acid |
InChI | InChI=1S/C32H50O4/c1-19-11-14-29(5)17-18-31(7)21(26(29)25(19)27(34)35)9-10-23-30(6)15-13-24(36-20(2)33)28(3,4)22(30)12-16-32(23,31)8/h9,19,22-26H,10-18H2,1-8H3,(H,34,35) |
InChIKey | BJOOCLFEDNCAQE-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2C3CCCCC3CCC2C4CCC5CCCCC5C4C1 |
Pathway | Superclass | Class |
Terpenoids|Terpenoids | Triterpenoids|Triterpenoids | Oleanane triterpenoids|Ursane and Taraxastane triterpenoids |
Total atom number | 86 |
Heavy atom number | 36 |
Bond count | 40 |
Number of carbons | 32 |
Minimal number of rings | 5 |
Maximal number of rings | 14 |
NP-likeness score | 1.17 |
Alogp | 6.64 |
Alogp2 | 44.04 |
Apol | 92.8677 |
Bpol | 58.4923 |
EccentricConnectivityIndexDescriptor | 840 |
FmfDescriptor | 0.6111 |
Fsp3 | 0.875 |
FragmentComplexityDescriptor | 6840.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 3490 |
Xlogp | 10.099 |
ZagrebIndex | 216 |
TopoPSA | 63.6 |