Name | 3-(4-hydroxy-3-methoxyphenyl)propyl 3-phenylprop-2-enoate |
Wikidata | Q104976866 |
Mol. formula | C19H20O4 |
CAS registry number | - |
Mol. weight | 312.3604 |
Temporary LOTUS id | LTS0088397 |
Name | 3-(4-hydroxy-3-methoxyphenyl)propyl 3-phenylprop-2-enoate |
Canonical SMILES | COc1cc(CCCOC(=O)C=Cc2ccccc2)ccc1O |
2D SMILES | COc1cc(CCCOC(=O)C=Cc2ccccc2)ccc1O |
IUPAC name | 3-(4-hydroxy-3-methoxyphenyl)propyl 3-phenylprop-2-enoate |
InChI | InChI=1S/C19H20O4/c1-22-18-14-16(9-11-17(18)20)8-5-13-23-19(21)12-10-15-6-3-2-4-7-15/h2-4,6-7,9-12,14,20H,5,8,13H2,1H3 |
InChIKey | DDUUXAFUHDOCTG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CC=Cc1ccccc1)CCCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenylpropanoids (C6-C3) | Cinnamic acids and derivatives |
Total atom number | 43 |
Heavy atom number | 23 |
Bond count | 24 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 4.23 |
Alogp2 | 17.9 |
Apol | 49.9839 |
Bpol | 26.6541 |
EccentricConnectivityIndexDescriptor | 569 |
FmfDescriptor | 0.8261 |
Fsp3 | 0.2105 |
FragmentComplexityDescriptor | 1430.04 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1552 |
Xlogp | 3.697 |
ZagrebIndex | 108 |
TopoPSA | 55.76 |