Name | 16-methoxy-14-oxapentacyclo[20.2.2.2¹⁰,¹³.1¹⁵,¹⁹.0²,⁷]nonacosa-1(25),2,4,6,10,12,15(27),16,18,22(26),23,28-dodecaene-5,24-diol |
Wikidata | Q104402555 |
Mol. formula | C29H26O4 |
CAS registry number | - |
Mol. weight | 438.5154 |
Temporary LOTUS id | LTS0087931 |
Name | 16-methoxy-14-oxapentacyclo[20.2.2.2¹⁰,¹³.1¹⁵,¹⁹.0²,⁷]nonacosa-1(25),2,4,6,10,12,15(27),16,18,22(26),23,28-dodecaene-5,24-diol |
Canonical SMILES | COc1ccc2cc1Oc1ccc(cc1)CCc1cc(O)ccc1-c1ccc(cc1O)CC2 |
2D SMILES | COc1ccc2cc1Oc1ccc(cc1)CCc1cc(O)ccc1-c1ccc(cc1O)CC2 |
IUPAC name | 16-methoxy-14-oxapentacyclo[20.2.2.2¹⁰,¹³.1¹⁵,¹⁹.0²,⁷]nonacosa-1(25),2,4,6,10,12,15(27),16,18,22(26),23,28-dodecaene-5,24-diol |
InChI | InChI=1S/C29H26O4/c1-32-28-15-8-21-3-2-20-7-13-26(27(31)16-20)25-14-10-23(30)18-22(25)9-4-19-5-11-24(12-6-19)33-29(28)17-21/h5-8,10-18,30-31H,2-4,9H2,1H3 |
InChIKey | JYKRDVGMNOVIMG-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2)CCc3ccccc3-c4ccc(cc4)CCc5cccc1c5 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Diarylheptanoids|Phenanthrenoids | Diarylether type diarylheptanoids|Phenanthrenes |
Total atom number | 59 |
Heavy atom number | 33 |
Bond count | 37 |
Number of carbons | 29 |
Minimal number of rings | 5 |
Maximal number of rings | 12 |
NP-likeness score | 1 |
Alogp | 7.39 |
Alogp2 | 54.6 |
Apol | 71.5846 |
Bpol | 32.2554 |
EccentricConnectivityIndexDescriptor | 798 |
FmfDescriptor | 0.8788 |
Fsp3 | 0.1724 |
FragmentComplexityDescriptor | 2913.04 |
PetitjeanNumber | 0.3571 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2994 |
Xlogp | 6.948 |
ZagrebIndex | 178 |
TopoPSA | 58.92 |