Name | (1r,17s,18s,19r)-9,12,13,14-tetramethoxy-18,19-dimethyl-5,7,20-trioxapentacyclo[15.2.1.0²,¹⁰.0⁴,⁸.0¹¹,¹⁶]icosa-2(10),3,8,11(16),12,14-hexaene |
Wikidata | Q15425792 |
Mol. formula | C23H26O7 |
CAS registry number | - |
Mol. weight | 414.4492 |
Temporary LOTUS id | LTS0086529 |
Name | (1r,17s,18s,19r)-9,12,13,14-tetramethoxy-18,19-dimethyl-5,7,20-trioxapentacyclo[15.2.1.0²,¹⁰.0⁴,⁸.0¹¹,¹⁶]icosa-2(10),3,8,11(16),12,14-hexaene |
Canonical SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)[C@@H]1O[C@H]2[C@@H](C)[C@H]1C |
2D SMILES | COc1cc2c(c(OC)c1OC)-c1c(cc3c(c1OC)OCO3)C1OC2C(C)C1C |
IUPAC name | (1R,17S,18S,19R)-9,12,13,14-tetramethoxy-18,19-dimethyl-5,7,20-trioxapentacyclo[15.2.1.0²,¹⁰.0⁴,⁸.0¹¹,¹⁶]icosa-2(10),3,8,11(16),12,14-hexaene |
InChI | InChI=1S/C23H26O7/c1-10-11(2)19-13-8-15-21(29-9-28-15)23(27-6)17(13)16-12(18(10)30-19)7-14(24-3)20(25-4)22(16)26-5/h7-8,10-11,18-19H,9H2,1-6H3/t10-,11+,18-,19+/m0/s1 |
InChIKey | RNIZTMIJCBCDBR-XJSVZPCESA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cc3-c4ccccc4C5OC(c3cc2OC1)CC5 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Dibenzocyclooctadienes lignans |
Total atom number | 56 |
Heavy atom number | 30 |
Bond count | 34 |
Number of carbons | 23 |
Minimal number of rings | 5 |
Maximal number of rings | 17 |
NP-likeness score | 1 |
Alogp | 3.77 |
Alogp2 | 14.18 |
Apol | 63.4306 |
Bpol | 41.8354 |
EccentricConnectivityIndexDescriptor | 513 |
FmfDescriptor | 0.6667 |
Fsp3 | 0.4783 |
FragmentComplexityDescriptor | 2730.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1947 |
Xlogp | 3.813 |
ZagrebIndex | 172 |
TopoPSA | 64.61 |