Name | [(7s,9s,11ar)-9-(acetyloxy)-7-hydroperoxy-6,10-dimethyl-2-oxo-4h,7h,8h,9h,11ah-cyclodeca[b]furan-3-yl]methyl acetate |
Wikidata | Q105385173 |
Mol. formula | C19H24O8 |
CAS registry number | - |
Mol. weight | 380.3898 |
Temporary LOTUS id | LTS0085723 |
Name | [(7s,9s,11ar)-9-(acetyloxy)-7-hydroperoxy-6,10-dimethyl-2-oxo-4h,7h,8h,9h,11ah-cyclodeca[b]furan-3-yl]methyl acetate |
Canonical SMILES | CC(=O)OCC1=C2C/C=C(/C)[C@@H](OO)C[C@H](OC(C)=O)/C(C)=C/[C@H]2OC1=O |
2D SMILES | CC(=O)OCC1=C2CC=C(C)C(OO)CC(OC(C)=O)C(C)=CC2OC1=O |
IUPAC name | [(7S,9S,11aR)-9-(acetyloxy)-7-hydroperoxy-6,10-dimethyl-2-oxo-2H,4H,7H,8H,9H,11aH-cyclodeca[b]furan-3-yl]methyl acetate |
InChI | InChI=1S/C19H24O8/c1-10-5-6-14-15(9-24-12(3)20)19(22)26-18(14)7-11(2)16(25-13(4)21)8-17(10)27-23/h5,7,16-18,23H,6,8-9H2,1-4H3/b10-5-,11-7+/t16-,17-,18+/m0/s1 |
InChIKey | ZWRRBFVVFRYDGA-XCUBJHMRSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C2CC=CCCCC=CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 51 |
Heavy atom number | 27 |
Bond count | 28 |
Number of carbons | 19 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 1.99 |
Alogp2 | 3.95 |
Apol | 55.859 |
Bpol | 34.859 |
EccentricConnectivityIndexDescriptor | 502 |
FmfDescriptor | 0.4815 |
Fsp3 | 0.5263 |
FragmentComplexityDescriptor | 2002.08 |
PetitjeanNumber | 0.4167 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1762 |
Xlogp | 0.355 |
ZagrebIndex | 134 |
TopoPSA | 108.36 |