Name | (1s,5r,6r)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol |
Wikidata | Q82265929 |
Mol. formula | C10H16O |
CAS registry number | - |
Mol. weight | 152.2338 |
Temporary LOTUS id | LTS0084441 |
Name | (1s,5r,6r)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol |
Canonical SMILES | CC1=CC[C@H]2[C@@H](O)[C@@H]1C2(C)C |
2D SMILES | CC1=CCC2C(O)C1C2(C)C |
IUPAC name | (1S,5R,6R)-2,7,7-trimethylbicyclo[3.1.1]hept-2-en-6-ol |
InChI | InChI=1S/C10H16O/c1-6-4-5-7-9(11)8(6)10(7,2)3/h4,7-9,11H,5H2,1-3H3/t7-,8+,9+/m0/s1 |
InChIKey | IRZWAJHUWGZMMT-DJLDLDEBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CC(C1)C2 |
Pathway | Superclass | Class |
Terpenoids | Monoterpenoids | Pinane monoterpenoids |
Total atom number | 27 |
Heavy atom number | 11 |
Bond count | 12 |
Number of carbons | 10 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 1.77 |
Alogp2 | 3.14 |
Apol | 29.0707 |
Bpol | 17.4913 |
EccentricConnectivityIndexDescriptor | 81 |
FmfDescriptor | 0.6364 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 674.01 |
PetitjeanNumber | 0.25 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 132 |
Xlogp | 1.881 |
ZagrebIndex | 64 |
TopoPSA | 20.23 |