Name | 5-(5-hydroxypentan-2-yl)-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl 3-methylpentanoate |
Wikidata | Q105236533 |
Mol. formula | C21H32O5 |
CAS registry number | - |
Mol. weight | 364.4766 |
Temporary LOTUS id | LTS0082820 |
Name | 5-(5-hydroxypentan-2-yl)-6-methyl-3-methylidene-2-oxo-3a,4,7,7a-tetrahydro-1-benzofuran-4-yl 3-methylpentanoate |
Canonical SMILES | C=C1C(=O)OC2CC(C)=C(C(C)CCCO)C(OC(=O)CC(C)CC)C12 |
2D SMILES | C=C1C(=O)OC2CC(C)=C(C(C)CCCO)C(OC(=O)CC(C)CC)C12 |
IUPAC name | 5-(5-hydroxypentan-2-yl)-6-methyl-3-methylidene-2-oxo-2,3,3a,4,7,7a-hexahydro-1-benzofuran-4-yl 3-methylpentanoate |
InChI | InChI=1S/C21H32O5/c1-6-12(2)10-17(23)26-20-18(13(3)8-7-9-22)14(4)11-16-19(20)15(5)21(24)25-16/h12-13,16,19-20,22H,5-11H2,1-4H3 |
InChIKey | RHNRTKTXTFENOC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CC=CCC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 58 |
Heavy atom number | 26 |
Bond count | 27 |
Number of carbons | 21 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 0.99 |
Alogp | 4.02 |
Alogp2 | 16.12 |
Apol | 62.3074 |
Bpol | 40.7306 |
EccentricConnectivityIndexDescriptor | 468 |
FmfDescriptor | 0.3462 |
Fsp3 | 0.7143 |
FragmentComplexityDescriptor | 2831.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1597 |
Xlogp | 3.076 |
ZagrebIndex | 130 |
TopoPSA | 72.83 |