Name | (2s)-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate |
Wikidata | Q105206419 |
Mol. formula | C10H12O7 |
CAS registry number | - |
Mol. weight | 244.1985 |
Temporary LOTUS id | LTS0082397 |
Name | (2s)-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate |
Canonical SMILES | O=C(OC[C@@H](O)CO)c1cc(O)c(O)c(O)c1 |
2D SMILES | O=C(OCC(O)CO)c1cc(O)c(O)c(O)c1 |
IUPAC name | (2S)-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate |
InChI | InChI=1S/C10H12O7/c11-3-6(12)4-17-10(16)5-1-7(13)9(15)8(14)2-5/h1-2,6,11-15H,3-4H2/t6-/m0/s1 |
InChIKey | PDEQYQCQYAQJPN-LURJTMIESA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Phenolic acids (C6-C1) | Gallotannins |
Total atom number | 29 |
Heavy atom number | 17 |
Bond count | 17 |
Number of carbons | 10 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | -0.17 |
Alogp2 | 0.03 |
Apol | 31.2155 |
Bpol | 15.9925 |
EccentricConnectivityIndexDescriptor | 257 |
FmfDescriptor | 0.3529 |
Fsp3 | 0.3 |
FragmentComplexityDescriptor | 569.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 562 |
Xlogp | -0.051 |
ZagrebIndex | 80 |
TopoPSA | 127.45 |