Name | 1-{2,4,6-trihydroxy-3-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2h-1-benzopyran-4-yl]phenyl}dodecan-1-one |
Wikidata | Q82904800 |
Mol. formula | C33H40O7 |
CAS registry number | - |
Mol. weight | 548.6677 |
Temporary LOTUS id | LTS0081947 |
Name | 1-{2,4,6-trihydroxy-3-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2h-1-benzopyran-4-yl]phenyl}dodecan-1-one |
Canonical SMILES | CCCCCCCCCCCC(=O)c1c(O)cc(O)c(C2CC(c3ccc(O)cc3)Oc3cc(O)ccc32)c1O |
2D SMILES | CCCCCCCCCCCC(=O)c1c(O)cc(O)c(C2CC(c3ccc(O)cc3)Oc3cc(O)ccc32)c1O |
IUPAC name | 1-{2,4,6-trihydroxy-3-[7-hydroxy-2-(4-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-yl]phenyl}dodecan-1-one |
InChI | InChI=1S/C33H40O7/c1-2-3-4-5-6-7-8-9-10-11-26(36)32-28(38)20-27(37)31(33(32)39)25-19-29(21-12-14-22(34)15-13-21)40-30-18-23(35)16-17-24(25)30/h12-18,20,25,29,34-35,37-39H,2-11,19H2,1H3 |
InChIKey | JGXZVDAPLSTBGZ-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2C(c3ccccc3)CC1c4ccccc4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Flavonoids|Flavonoids | Flavan-3-ols|Flavanones |
Total atom number | 80 |
Heavy atom number | 40 |
Bond count | 43 |
Number of carbons | 33 |
Minimal number of rings | 4 |
Maximal number of rings | 5 |
NP-likeness score | 1.01 |
Alogp | 8.42 |
Alogp2 | 70.83 |
Apol | 90.3657 |
Bpol | 46.6023 |
EccentricConnectivityIndexDescriptor | 1411 |
FmfDescriptor | 0.55 |
Fsp3 | 0.4242 |
FragmentComplexityDescriptor | 5329.07 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 3 |
WienerPathNumber | 5935 |
Xlogp | 9.523 |
ZagrebIndex | 204 |
TopoPSA | 127.45 |