Name | (5r,6s,7as,8r,8ar)-8-acetyl-5,7a-dihydroxy-6-methoxy-3,5-dimethyl-6h,7h,8h,8ah-indeno[5,6-b]furan-2-one |
Wikidata | Q105173472 |
Mol. formula | C16H20O6 |
CAS registry number | - |
Mol. weight | 308.327 |
Temporary LOTUS id | LTS0080833 |
Name | (5r,6s,7as,8r,8ar)-8-acetyl-5,7a-dihydroxy-6-methoxy-3,5-dimethyl-6h,7h,8h,8ah-indeno[5,6-b]furan-2-one |
Canonical SMILES | CO[C@H]1C[C@@]2(O)C(=CC3=C(C)C(=O)O[C@@H]3[C@H]2C(C)=O)[C@@]1(C)O |
2D SMILES | COC1CC2(O)C(=CC3=C(C)C(=O)OC3C2C(C)=O)C1(C)O |
IUPAC name | (5R,6S,7aS,8R,8aR)-8-acetyl-5,7a-dihydroxy-6-methoxy-3,5-dimethyl-2H,5H,6H,7H,7aH,8H,8aH-indeno[5,6-b]furan-2-one |
InChI | InChI=1S/C16H20O6/c1-7-9-5-10-15(3,19)11(21-4)6-16(10,20)12(8(2)17)13(9)22-14(7)18/h5,11-13,19-20H,6H2,1-4H3/t11-,12+,13-,15+,16+/m0/s1 |
InChIKey | MWAIQZYWLADOIR-XNHWPECASA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CC=C2C=C3CCCC3CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 42 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 16 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.6 |
Alogp | -0.64 |
Alogp2 | 0.41 |
Apol | 46.3079 |
Bpol | 27.6121 |
EccentricConnectivityIndexDescriptor | 306 |
FmfDescriptor | 0.5455 |
Fsp3 | 0.625 |
FragmentComplexityDescriptor | 1474.06 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 862 |
Xlogp | -1.286 |
ZagrebIndex | 128 |
TopoPSA | 93.06 |