Name | 5-(3,4-dihydroxyphenyl)-4,11,12-trihydroxy-8-oxatricyclo[7.4.0.0²,⁷]trideca-1(13),2(7),4,9,11-pentaene-3,6-dione |
Wikidata | Q105368091 |
Mol. formula | C18H10O8 |
CAS registry number | - |
Mol. weight | 354.2679 |
Temporary LOTUS id | LTS0078990 |
Name | 5-(3,4-dihydroxyphenyl)-4,11,12-trihydroxy-8-oxatricyclo[7.4.0.0²,⁷]trideca-1(13),2(7),4,9,11-pentaene-3,6-dione |
Canonical SMILES | O=C1C(c2ccc(O)c(O)c2)=C(O)C(=O)c2c1oc1cc(O)c(O)cc21 |
2D SMILES | O=C1C(c2ccc(O)c(O)c2)=C(O)C(=O)c2c1oc1cc(O)c(O)cc21 |
IUPAC name | 5-(3,4-dihydroxyphenyl)-4,11,12-trihydroxy-8-oxatricyclo[7.4.0.0²,⁷]trideca-1(13),2(7),4,9,11-pentaene-3,6-dione |
InChI | InChI=1S/C18H10O8/c19-8-2-1-6(3-9(8)20)13-15(23)16(24)14-7-4-10(21)11(22)5-12(7)26-18(14)17(13)25/h1-5,19-23H |
InChIKey | YXRBIRYXOSYHBV-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | o1c2ccccc2c3c1CC(=CC3)c4ccccc4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Terphenyls | p-Terphenyls |
Total atom number | 36 |
Heavy atom number | 26 |
Bond count | 29 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.24 |
Alogp | 2.2 |
Alogp2 | 4.83 |
Apol | 44.7639 |
Bpol | 14.7641 |
EccentricConnectivityIndexDescriptor | 515 |
FmfDescriptor | 0.7308 |
Fsp3 | 0 |
FragmentComplexityDescriptor | 871.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1527 |
Xlogp | 2.896 |
ZagrebIndex | 148 |
TopoPSA | 148.43 |