Name | (-)-5-silphiperfolene |
Wikidata | Q76535319 |
Mol. formula | C15H24 |
CAS registry number | - |
Mol. weight | 204.3516 |
Temporary LOTUS id | LTS0077856 |
Name | (-)-5-silphiperfolene |
Canonical SMILES | CC1=C[C@@]2(C)CC[C@@H]3[C@@H](C)CC[C@@]32[C@H]1C |
2D SMILES | CC1=CC2(C)CCC3C(C)CCC32C1C |
IUPAC name | (1S,2S,5R,8R,9S)-2,3,5,9-tetramethyltricyclo[6.3.0.0¹,⁵]undec-3-ene |
InChI | InChI=1S/C15H24/c1-10-5-8-15-12(3)11(2)9-14(15,4)7-6-13(10)15/h9-10,12-13H,5-8H2,1-4H3/t10-,12-,13+,14+,15+/m0/s1 |
InChIKey | OVRIZVNVMIWWMN-VNUKXSOBSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=CC2CCC3CCCC23C1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Silphiperfolane sesquiterpenoids |
Total atom number | 39 |
Heavy atom number | 15 |
Bond count | 17 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 4.12 |
Alogp2 | 17 |
Apol | 42.403 |
Bpol | 26.237 |
EccentricConnectivityIndexDescriptor | 150 |
FmfDescriptor | 0.7333 |
Fsp3 | 0.8667 |
FragmentComplexityDescriptor | 1471 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 289 |
Xlogp | 6.399 |
ZagrebIndex | 92 |
TopoPSA | 0 |