Name | (1r,2s,5s,8r,9r,17r)-17-hydroxy-9,13,13-trimethyl-4-methylidene-16-oxapentacyclo[7.6.1.1²,⁵.0²,⁸.0¹⁰,¹⁴]heptadec-10-en-3-one |
Wikidata | Q104972371 |
Mol. formula | C20H26O3 |
CAS registry number | - |
Mol. weight | 314.4194 |
Temporary LOTUS id | LTS0077059 |
Name | (1r,2s,5s,8r,9r,17r)-17-hydroxy-9,13,13-trimethyl-4-methylidene-16-oxapentacyclo[7.6.1.1²,⁵.0²,⁸.0¹⁰,¹⁴]heptadec-10-en-3-one |
Canonical SMILES | C=C1C(=O)[C@@]23[C@H]4CC5C(=CCC5(C)C)[C@](C)(O4)[C@@H]2CC[C@@H]1[C@H]3O |
2D SMILES | C=C1C(=O)C23C4CC5C(=CCC5(C)C)C(C)(O4)C2CCC1C3O |
IUPAC name | (1R,2S,5S,8R,9R,17R)-17-hydroxy-9,13,13-trimethyl-4-methylidene-16-oxapentacyclo[7.6.1.1²,⁵.0²,⁸.0¹⁰,¹⁴]heptadec-10-en-3-one |
InChI | InChI=1S/C20H26O3/c1-10-11-5-6-14-19(4)12-7-8-18(2,3)13(12)9-15(23-19)20(14,16(10)21)17(11)22/h7,11,13-15,17,22H,1,5-6,8-9H2,2-4H3/t11-,13?,14-,15+,17+,19-,20-/m0/s1 |
InChIKey | CYJRXJPSWBHVJE-FIKLVZOVSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C2C3=CCCC3CC1C45CCC(CCC24)C5 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Kaurane and Phyllocladane diterpenoids |
Total atom number | 49 |
Heavy atom number | 23 |
Bond count | 27 |
Number of carbons | 20 |
Minimal number of rings | 5 |
Maximal number of rings | 15 |
NP-likeness score | 1.07 |
Alogp | 2.26 |
Alogp2 | 5.09 |
Apol | 54.9426 |
Bpol | 31.2974 |
EccentricConnectivityIndexDescriptor | 329 |
FmfDescriptor | 0.7391 |
Fsp3 | 0.75 |
FragmentComplexityDescriptor | 2303.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 913 |
Xlogp | 1.68 |
ZagrebIndex | 150 |
TopoPSA | 46.53 |