Name | 2-(4-hydroxyphenyl)-3,6-dimethoxy-8,8-dimethylpyrano[2,3-h]chromen-4-one |
Wikidata | Q105149574 |
Mol. formula | C22H20O6 |
CAS registry number | - |
Mol. weight | 380.3914 |
Temporary LOTUS id | LTS0075526 |
Name | 2-(4-hydroxyphenyl)-3,6-dimethoxy-8,8-dimethylpyrano[2,3-h]chromen-4-one |
Canonical SMILES | COc1cc2c(=O)c(OC)c(-c3ccc(O)cc3)oc2c2c1OC(C)(C)C=C2 |
2D SMILES | COc1cc2c(=O)c(OC)c(-c3ccc(O)cc3)oc2c2c1OC(C)(C)C=C2 |
IUPAC name | 2-(4-hydroxyphenyl)-3,6-dimethoxy-8,8-dimethyl-4H,8H-pyrano[2,3-h]chromen-4-one |
InChI | InChI=1S/C22H20O6/c1-22(2)10-9-14-19-15(11-16(25-3)20(14)28-22)17(24)21(26-4)18(27-19)12-5-7-13(23)8-6-12/h5-11,23H,1-4H3 |
InChIKey | LBQMBIWFYFFSFY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1C(=CCc2ccc3OCC=Cc3c12)c4ccccc4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Flavonols |
Total atom number | 48 |
Heavy atom number | 28 |
Bond count | 31 |
Number of carbons | 22 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 4.32 |
Alogp2 | 18.63 |
Apol | 56.8679 |
Bpol | 30.4861 |
EccentricConnectivityIndexDescriptor | 563 |
FmfDescriptor | 0.7143 |
Fsp3 | 0.2273 |
FragmentComplexityDescriptor | 1845.06 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1856 |
Xlogp | 4.883 |
ZagrebIndex | 156 |
TopoPSA | 78.13 |