Name | (2e,10e)-11-(2h-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)undeca-2,10-dien-1-one |
Wikidata | Q104959086 |
Mol. formula | C23H31NO3 |
CAS registry number | - |
Mol. weight | 369.498 |
Temporary LOTUS id | LTS0074814 |
Name | (2e,10e)-11-(2h-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)undeca-2,10-dien-1-one |
Canonical SMILES | O=C(/C=C/CCCCCC/C=C/c1ccc2c(c1)OCO2)N1CCCCC1 |
2D SMILES | O=C(C=CCCCCCCC=Cc1ccc2c(c1)OCO2)N1CCCCC1 |
IUPAC name | (2E,10E)-11-(2H-1,3-benzodioxol-5-yl)-1-(piperidin-1-yl)undeca-2,10-dien-1-one |
InChI | InChI=1S/C23H31NO3/c25-23(24-16-10-7-11-17-24)13-9-6-4-2-1-3-5-8-12-20-14-15-21-22(18-20)27-19-26-21/h8-9,12-15,18H,1-7,10-11,16-17,19H2/b12-8+,13-9+ |
InChIKey | CHOLQJRIMZGPNC-QHKWOANTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(C=CCCCCCCC=CCN3CCCCC3)cc2OC1 |
Pathway | Superclass | Class |
Alkaloids | Lysine alkaloids | Piperidine alkaloids |
Total atom number | 58 |
Heavy atom number | 27 |
Bond count | 29 |
Number of carbons | 23 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 0.94 |
Alogp | 5.6 |
Alogp2 | 31.38 |
Apol | 64.6566 |
Bpol | 40.6594 |
EccentricConnectivityIndexDescriptor | 887 |
FmfDescriptor | 0.963 |
Fsp3 | 0.5217 |
FragmentComplexityDescriptor | 2898.04 |
PetitjeanNumber | 0.4737 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2699 |
Xlogp | 6.23 |
ZagrebIndex | 130 |
TopoPSA | 38.77 |