Name | (8r,9e,11s,12s)-8,11,12-trihydroxyoctadec-9-enoic acid |
Wikidata | Q105347518 |
Mol. formula | C18H34O5 |
CAS registry number | - |
Mol. weight | 330.4603 |
Temporary LOTUS id | LTS0074775 |
Name | (8r,9e,11s,12s)-8,11,12-trihydroxyoctadec-9-enoic acid |
Canonical SMILES | CCCCCC[C@H](O)[C@@H](O)/C=C/[C@H](O)CCCCCCC(=O)O |
2D SMILES | CCCCCCC(O)C(O)C=CC(O)CCCCCCC(=O)O |
IUPAC name | (8R,9E,11S,12S)-8,11,12-trihydroxyoctadec-9-enoic acid |
InChI | InChI=1S/C18H34O5/c1-2-3-4-8-11-16(20)17(21)14-13-15(19)10-7-5-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+/t15-,16+,17+/m1/s1 |
InChIKey | YFCZLXRIKFCQFU-ACWVRRSXSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Octadecanoids | Other Octadecanoids |
Total atom number | 57 |
Heavy atom number | 23 |
Bond count | 22 |
Number of carbons | 18 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.26 |
Alogp | 3.66 |
Alogp2 | 13.43 |
Apol | 58.361 |
Bpol | 38.127 |
EccentricConnectivityIndexDescriptor | 590 |
FmfDescriptor | 0 |
Fsp3 | 0.8333 |
FragmentComplexityDescriptor | 2630.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 1702 |
Xlogp | 3.735 |
ZagrebIndex | 94 |
TopoPSA | 97.99 |