Name | 2-(3-hydroxybenzoyl)-5-methoxy-4-[(2r)-5-methyl-2-(prop-1-en-2-yl)hex-5-en-1-yl]-6-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
Wikidata | Q105162088 |
Mol. formula | C29H36O5 |
CAS registry number | - |
Mol. weight | 464.5942 |
Temporary LOTUS id | LTS0072526 |
Name | 2-(3-hydroxybenzoyl)-5-methoxy-4-[(2r)-5-methyl-2-(prop-1-en-2-yl)hex-5-en-1-yl]-6-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
Canonical SMILES | C=C(C)CC[C@H](Cc1c(O)c(C(=O)c2cccc(O)c2)c(O)c(CC=C(C)C)c1OC)C(=C)C |
2D SMILES | C=C(C)CCC(Cc1c(O)c(C(=O)c2cccc(O)c2)c(O)c(CC=C(C)C)c1OC)C(=C)C |
IUPAC name | 2-(3-hydroxybenzoyl)-5-methoxy-4-[(2R)-5-methyl-2-(prop-1-en-2-yl)hex-5-en-1-yl]-6-(3-methylbut-2-en-1-yl)benzene-1,3-diol |
InChI | InChI=1S/C29H36O5/c1-17(2)11-13-20(19(5)6)16-24-28(33)25(26(31)21-9-8-10-22(30)15-21)27(32)23(29(24)34-7)14-12-18(3)4/h8-10,12,15,20,30,32-33H,1,5,11,13-14,16H2,2-4,6-7H3/t20-/m1/s1 |
InChIKey | MDZVTKOPDGCETA-HXUWFJFHSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)Cc2ccccc2 |
Pathway | Superclass | Class |
Polyketides | Phloroglucinols | Prenylated,geranylated phloroglucinols |
Total atom number | 70 |
Heavy atom number | 34 |
Bond count | 35 |
Number of carbons | 29 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.01 |
Alogp | 7.86 |
Alogp2 | 61.76 |
Apol | 79.0545 |
Bpol | 42.2295 |
EccentricConnectivityIndexDescriptor | 691 |
FmfDescriptor | 0.3824 |
Fsp3 | 0.3448 |
FragmentComplexityDescriptor | 3919.05 |
PetitjeanNumber | 0.4615 |
LipinskiRuleOf5Failures | 2 |
WienerPathNumber | 3269 |
Xlogp | 8.23 |
ZagrebIndex | 168 |
TopoPSA | 86.99 |