Name | (2r,3r,3as,7r,7as)-3,7-dihydroxy-2-phenyl-hexahydrofuro[3,2-b]pyran-5-one |
Wikidata | Q105023584 |
Mol. formula | C13H14O5 |
CAS registry number | - |
Mol. weight | 250.2478 |
Temporary LOTUS id | LTS0072235 |
Name | (2r,3r,3as,7r,7as)-3,7-dihydroxy-2-phenyl-hexahydrofuro[3,2-b]pyran-5-one |
Canonical SMILES | O=C1C[C@@H](O)[C@@H]2O[C@H](c3ccccc3)[C@@H](O)[C@@H]2O1 |
2D SMILES | O=C1CC(O)C2OC(c3ccccc3)C(O)C2O1 |
IUPAC name | (2R,3R,3aS,7R,7aS)-3,7-dihydroxy-2-phenyl-hexahydro-2H-furo[3,2-b]pyran-5-one |
InChI | InChI=1S/C13H14O5/c14-8-6-9(15)17-13-10(16)11(18-12(8)13)7-4-2-1-3-5-7/h1-5,8,10-14,16H,6H2/t8-,10-,11-,12+,13+/m1/s1 |
InChIKey | GYCYBXCAAVSCJA-XTAFZBPGSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCCC2OC(c3ccccc3)CC12 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Styrylpyrones | Kavalactones and derivatives |
Total atom number | 32 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 13 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.01 |
Alogp | 0.29 |
Alogp2 | 0.08 |
Apol | 36.2251 |
Bpol | 20.0949 |
EccentricConnectivityIndexDescriptor | 270 |
FmfDescriptor | 0.8333 |
Fsp3 | 0.4615 |
FragmentComplexityDescriptor | 850.05 |
PetitjeanNumber | 0.4444 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 568 |
Xlogp | 0.004 |
ZagrebIndex | 98 |
TopoPSA | 75.99 |