Name | (2e)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]prop-2-en-1-one |
Wikidata | Q105267774 |
Mol. formula | C25H28O5 |
CAS registry number | - |
Mol. weight | 408.4878 |
Temporary LOTUS id | LTS0072182 |
Name | (2e)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]prop-2-en-1-one |
Canonical SMILES | CC(C)=CCc1cc(/C=C/C(=O)c2ccc(O)c(CC=C(C)C)c2O)cc(O)c1O |
2D SMILES | CC(C)=CCc1cc(C=CC(=O)c2ccc(O)c(CC=C(C)C)c2O)cc(O)c1O |
IUPAC name | (2E)-1-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-3-[3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]prop-2-en-1-one |
InChI | InChI=1S/C25H28O5/c1-15(2)5-8-18-13-17(14-23(28)24(18)29)7-11-21(26)20-10-12-22(27)19(25(20)30)9-6-16(3)4/h5-7,10-14,27-30H,8-9H2,1-4H3/b11-7+ |
InChIKey | TYWUDTBLZIUYSV-YRNVUSSQSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)C=CCc2ccccc2 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Chalcones |
Total atom number | 58 |
Heavy atom number | 30 |
Bond count | 31 |
Number of carbons | 25 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.02 |
Alogp | 6.35 |
Alogp2 | 40.27 |
Apol | 66.6802 |
Bpol | 31.5678 |
EccentricConnectivityIndexDescriptor | 755 |
FmfDescriptor | 0.5 |
Fsp3 | 0.24 |
FragmentComplexityDescriptor | 2611.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2779 |
Xlogp | 6.15 |
ZagrebIndex | 148 |
TopoPSA | 97.99 |