Name | 2-(2h-1,3-benzodioxol-5-yl)-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
Wikidata | Q105346415 |
Mol. formula | C18H16O5 |
CAS registry number | - |
Mol. weight | 312.3173 |
Temporary LOTUS id | LTS0071733 |
Name | 2-(2h-1,3-benzodioxol-5-yl)-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
Canonical SMILES | COc1cc(C=O)cc2c1OC(c1ccc3c(c1)OCO3)C2C |
2D SMILES | COc1cc(C=O)cc2c1OC(c1ccc3c(c1)OCO3)C2C |
IUPAC name | 2-(2H-1,3-benzodioxol-5-yl)-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-5-carbaldehyde |
InChI | InChI=1S/C18H16O5/c1-10-13-5-11(8-19)6-16(20-2)18(13)23-17(10)12-3-4-14-15(7-12)22-9-21-14/h3-8,10,17H,9H2,1-2H3 |
InChIKey | YCQBSXRADODLES-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2OC1)C3Oc4ccccc4C3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Minor lignans |
Total atom number | 39 |
Heavy atom number | 23 |
Bond count | 26 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 6 |
NP-likeness score | 1 |
Alogp | 3.33 |
Alogp2 | 11.09 |
Apol | 46.3587 |
Bpol | 26.1133 |
EccentricConnectivityIndexDescriptor | 433 |
FmfDescriptor | 0.7826 |
Fsp3 | 0.2778 |
FragmentComplexityDescriptor | 1258.05 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1141 |
Xlogp | 2.989 |
ZagrebIndex | 128 |
TopoPSA | 53.99 |