Name | Methyl anthranilate |
Wikidata | Q420894 |
Mol. formula | C8H9NO2 |
CAS registry number | - |
Mol. weight | 151.1629 |
Temporary LOTUS id | LTS0069354 |
Name | Methyl anthranilate |
Canonical SMILES | COC(=O)c1ccccc1N |
2D SMILES | COC(=O)c1ccccc1N |
IUPAC name | methyl 2-aminobenzoate |
InChI | InChI=1S/C8H9NO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3 |
InChIKey | VAMXMNNIEUEQDV-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccccc1 |
Pathway | Superclass | Class |
Alkaloids | Anthranilic acid alkaloids | Anthranillic acid derivatives |
Total atom number | 20 |
Heavy atom number | 11 |
Bond count | 11 |
Number of carbons | 8 |
Minimal number of rings | 1 |
Maximal number of rings | 1 |
NP-likeness score | 1.01 |
Alogp | 0.94 |
Alogp2 | 0.88 |
Apol | 22.7851 |
Bpol | 12.0529 |
EccentricConnectivityIndexDescriptor | 99 |
FmfDescriptor | 0.5455 |
Fsp3 | 0.125 |
FragmentComplexityDescriptor | 290.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 152 |
Xlogp | 1.57 |
ZagrebIndex | 50 |
TopoPSA | 52.32 |