Name | 6,12-dihydroxy-5,7,13,14-tetramethoxy-2,9-dioxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione |
Wikidata | Q105227873 |
Mol. formula | C18H14O10 |
CAS registry number | - |
Mol. weight | 390.2985 |
Temporary LOTUS id | LTS0068678 |
Name | 6,12-dihydroxy-5,7,13,14-tetramethoxy-2,9-dioxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione |
Canonical SMILES | COc1c(OC)c2oc(=O)c3c(OC)c(O)c(OC)c4oc(=O)c(c1O)c2c43 |
2D SMILES | COc1c(OC)c2oc(=O)c3c(OC)c(O)c(OC)c4oc(=O)c(c1O)c2c43 |
IUPAC name | 6,12-dihydroxy-5,7,13,14-tetramethoxy-2,9-dioxatetracyclo[6.6.2.0⁴,¹⁶.0¹¹,¹⁵]hexadeca-1(15),4(16),5,7,11,13-hexaene-3,10-dione |
InChI | InChI=1S/C18H14O10/c1-23-11-8-6-5-7(17(21)27-12(6)15(25-3)10(11)20)9(19)14(24-2)16(26-4)13(5)28-18(8)22/h19-20H,1-4H3 |
InChIKey | QTQKYSFIBIIGRT-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2cccc3c2-c4c(OC3)cccc4C1 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids|Shikimates and Phenylpropanoids | Coumarins|Coumarins | |Simple coumarins |
Total atom number | 42 |
Heavy atom number | 28 |
Bond count | 31 |
Number of carbons | 18 |
Minimal number of rings | 4 |
Maximal number of rings | 14 |
NP-likeness score | 1 |
Alogp | 2.21 |
Alogp2 | 4.87 |
Apol | 49.0351 |
Bpol | 28.7169 |
EccentricConnectivityIndexDescriptor | 461 |
FmfDescriptor | 0.5714 |
Fsp3 | 0.2222 |
FragmentComplexityDescriptor | 1269.1 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1633 |
Xlogp | 2.45 |
ZagrebIndex | 158 |
TopoPSA | 137.8 |