Name | Dorsmanin a |
Wikidata | Q76309067 |
Mol. formula | C20H20O4 |
CAS registry number | - |
Mol. weight | 324.3712 |
Temporary LOTUS id | LTS0068388 |
Name | Dorsmanin a |
Canonical SMILES | CC1(C)CCc2c(ccc(C(=O)/C=C/c3ccc(O)cc3)c2O)O1 |
2D SMILES | CC1(C)CCc2c(ccc(C(=O)C=Cc3ccc(O)cc3)c2O)O1 |
IUPAC name | (2E)-1-(5-hydroxy-2,2-dimethyl-3,4-dihydro-2H-1-benzopyran-6-yl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
InChI | InChI=1S/C20H20O4/c1-20(2)12-11-16-18(24-20)10-8-15(19(16)23)17(22)9-5-13-3-6-14(21)7-4-13/h3-10,21,23H,11-12H2,1-2H3/b9-5+ |
InChIKey | UDSAJERKQRQHJR-WEVVVXLNSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccc(cc2CCC1)CC=Cc3ccccc3 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Flavonoids | Chalcones |
Total atom number | 44 |
Heavy atom number | 24 |
Bond count | 26 |
Number of carbons | 20 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.02 |
Alogp | 4.26 |
Alogp2 | 18.18 |
Apol | 51.7439 |
Bpol | 24.7381 |
EccentricConnectivityIndexDescriptor | 550 |
FmfDescriptor | 0.7917 |
Fsp3 | 0.25 |
FragmentComplexityDescriptor | 1564.04 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1464 |
Xlogp | 4.461 |
ZagrebIndex | 128 |
TopoPSA | 66.76 |