Name | (2s,4r)-4-ethenyl-2-(2-hydroxypropan-2-yl)-7-methyl-3,4-dihydro-2h-1-benzopyran-6-ol |
Wikidata | Q105278402 |
Mol. formula | C15H20O3 |
CAS registry number | - |
Mol. weight | 248.3181 |
Temporary LOTUS id | LTS0066970 |
Name | (2s,4r)-4-ethenyl-2-(2-hydroxypropan-2-yl)-7-methyl-3,4-dihydro-2h-1-benzopyran-6-ol |
Canonical SMILES | C=C[C@H]1C[C@@H](C(C)(C)O)Oc2cc(C)c(O)cc21 |
2D SMILES | C=CC1CC(C(C)(C)O)Oc2cc(C)c(O)cc21 |
IUPAC name | (2S,4R)-4-ethenyl-2-(2-hydroxypropan-2-yl)-7-methyl-3,4-dihydro-2H-1-benzopyran-6-ol |
InChI | InChI=1S/C15H20O3/c1-5-10-7-14(15(3,4)17)18-13-6-9(2)12(16)8-11(10)13/h5-6,8,10,14,16-17H,1,7H2,2-4H3/t10-,14-/m0/s1 |
InChIKey | USPLMZMYYNDHOT-HZMBPMFUSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1c2ccccc2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Bisabolane sesquiterpenoids |
Total atom number | 38 |
Heavy atom number | 18 |
Bond count | 19 |
Number of carbons | 15 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1.36 |
Alogp | 2.95 |
Alogp2 | 8.72 |
Apol | 42.1419 |
Bpol | 23.7801 |
EccentricConnectivityIndexDescriptor | 229 |
FmfDescriptor | 0.5556 |
Fsp3 | 0.4667 |
FragmentComplexityDescriptor | 1215.03 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 558 |
Xlogp | 2.983 |
ZagrebIndex | 96 |
TopoPSA | 49.69 |