Name | 1-{3-[(3-butanoyl-2,4-dihydroxy-6-methoxyphenyl)methyl]-2,6-dihydroxy-4-methoxyphenyl}butan-1-one |
Wikidata | Q105311957 |
Mol. formula | C23H28O8 |
CAS registry number | - |
Mol. weight | 432.4645 |
Temporary LOTUS id | LTS0065978 |
Name | 1-{3-[(3-butanoyl-2,4-dihydroxy-6-methoxyphenyl)methyl]-2,6-dihydroxy-4-methoxyphenyl}butan-1-one |
Canonical SMILES | CCCC(=O)c1c(O)cc(OC)c(Cc2c(OC)cc(O)c(C(=O)CCC)c2O)c1O |
2D SMILES | CCCC(=O)c1c(O)cc(OC)c(Cc2c(OC)cc(O)c(C(=O)CCC)c2O)c1O |
IUPAC name | 1-{3-[(3-butanoyl-2,4-dihydroxy-6-methoxyphenyl)methyl]-2,6-dihydroxy-4-methoxyphenyl}butan-1-one |
InChI | InChI=1S/C23H28O8/c1-5-7-14(24)20-16(26)10-18(30-3)12(22(20)28)9-13-19(31-4)11-17(27)21(23(13)29)15(25)8-6-2/h10-11,26-29H,5-9H2,1-4H3 |
InChIKey | WSMJKCGZGMHNMV-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc(cc1)Cc2ccccc2 |
Pathway | Superclass | Class |
Polyketides | Phloroglucinols | Dimeric phloroglucinols |
Total atom number | 59 |
Heavy atom number | 31 |
Bond count | 32 |
Number of carbons | 23 |
Minimal number of rings | 2 |
Maximal number of rings | 2 |
NP-likeness score | 1.03 |
Alogp | 4.43 |
Alogp2 | 19.61 |
Apol | 65.5662 |
Bpol | 36.3578 |
EccentricConnectivityIndexDescriptor | 660 |
FmfDescriptor | 0.4194 |
Fsp3 | 0.3913 |
FragmentComplexityDescriptor | 2670.08 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 2556 |
Xlogp | 5.097 |
ZagrebIndex | 154 |
TopoPSA | 133.52 |