Name | Acetoxyacetone |
Wikidata | Q27275533 |
Mol. formula | C5H8O3 |
CAS registry number | - |
Mol. weight | 116.1154 |
Temporary LOTUS id | LTS0065698 |
Name | Acetoxyacetone |
Canonical SMILES | CC(=O)COC(C)=O |
2D SMILES | CC(=O)COC(C)=O |
IUPAC name | 2-oxopropyl acetate |
InChI | InChI=1S/C5H8O3/c1-4(6)3-8-5(2)7/h3H2,1-2H3 |
InChIKey | DBERHVIZRVGDFO-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | not applicable |
Pathway | Superclass | Class |
Fatty acids | Fatty acyls | Oxygenated hydrocarbons |
Total atom number | 16 |
Heavy atom number | 8 |
Bond count | 7 |
Number of carbons | 5 |
Minimal number of rings | 0 |
Maximal number of rings | 0 |
NP-likeness score | 1.08 |
Alogp | -0.32 |
Alogp2 | 0.1 |
Apol | 16.5403 |
Bpol | 12.5777 |
EccentricConnectivityIndexDescriptor | 56 |
FmfDescriptor | 0 |
Fsp3 | 0.6 |
FragmentComplexityDescriptor | 169.03 |
PetitjeanNumber | 0.4 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 74 |
Xlogp | -0.112 |
ZagrebIndex | 30 |
TopoPSA | 43.37 |