Name | (3r,3as,4r,9r,9as,9bs)-9-hydroxy-3,6,9-trimethyl-2-oxo-3h,3ah,4h,5h,9ah,9bh-azuleno[4,5-b]furan-4-yl acetate |
Wikidata | Q105263786 |
Mol. formula | C17H22O5 |
CAS registry number | - |
Mol. weight | 306.3542 |
Temporary LOTUS id | LTS0065390 |
Name | (3r,3as,4r,9r,9as,9bs)-9-hydroxy-3,6,9-trimethyl-2-oxo-3h,3ah,4h,5h,9ah,9bh-azuleno[4,5-b]furan-4-yl acetate |
Canonical SMILES | CC(=O)O[C@@H]1CC(C)=C2C=C[C@@](C)(O)[C@@H]2[C@H]2OC(=O)[C@H](C)[C@H]21 |
2D SMILES | CC(=O)OC1CC(C)=C2C=CC(C)(O)C2C2OC(=O)C(C)C12 |
IUPAC name | (3R,3aS,4R,9R,9aS,9bS)-9-hydroxy-3,6,9-trimethyl-2-oxo-2H,3H,3aH,4H,5H,9H,9aH,9bH-azuleno[4,5-b]furan-4-yl acetate |
InChI | InChI=1S/C17H22O5/c1-8-7-12(21-10(3)18)13-9(2)16(19)22-15(13)14-11(8)5-6-17(14,4)20/h5-6,9,12-15,20H,7H2,1-4H3/t9-,12-,13+,14+,15+,17-/m1/s1 |
InChIKey | SYTRJRUSWMMZLV-YLGNKLDISA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC=C3C=CCC3C12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 44 |
Heavy atom number | 22 |
Bond count | 24 |
Number of carbons | 17 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 1.31 |
Alogp | 1.16 |
Alogp2 | 1.36 |
Apol | 48.5994 |
Bpol | 29.7986 |
EccentricConnectivityIndexDescriptor | 294 |
FmfDescriptor | 0.5909 |
Fsp3 | 0.6471 |
FragmentComplexityDescriptor | 1654.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 885 |
Xlogp | 0.548 |
ZagrebIndex | 124 |
TopoPSA | 72.83 |