Name | 3,8,11-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.0¹,¹⁰.0⁴,⁹]hexadecan-6-yl acetate |
Wikidata | Q104994470 |
Mol. formula | C22H32O6 |
CAS registry number | - |
Mol. weight | 392.4867 |
Temporary LOTUS id | LTS0064872 |
Name | 3,8,11-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.0¹,¹⁰.0⁴,⁹]hexadecan-6-yl acetate |
Canonical SMILES | C=C1C(=O)C23CC1CC(O)C2C1(C)C(O)CC(OC(C)=O)C(C)(C)C1C(O)C3 |
2D SMILES | C=C1C(=O)C23CC1CC(O)C2C1(C)C(O)CC(OC(C)=O)C(C)(C)C1C(O)C3 |
IUPAC name | 3,8,11-trihydroxy-5,5,9-trimethyl-14-methylidene-15-oxotetracyclo[11.2.1.0¹,¹⁰.0⁴,⁹]hexadecan-6-yl acetate |
InChI | InChI=1S/C22H32O6/c1-10-12-6-13(24)18-21(5)15(26)7-16(28-11(2)23)20(3,4)17(21)14(25)9-22(18,8-12)19(10)27/h12-18,24-26H,1,6-9H2,2-5H3 |
InChIKey | FFIXBFRNWSCZIU-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1CCC2C(C1)CCC34CCC(CCC23)C4 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Kaurane and Phyllocladane diterpenoids |
Total atom number | 60 |
Heavy atom number | 28 |
Bond count | 31 |
Number of carbons | 22 |
Minimal number of rings | 4 |
Maximal number of rings | 10 |
NP-likeness score | 1.07 |
Alogp | 0.62 |
Alogp2 | 0.39 |
Apol | 64.8694 |
Bpol | 38.8146 |
EccentricConnectivityIndexDescriptor | 495 |
FmfDescriptor | 0.5714 |
Fsp3 | 0.8182 |
FragmentComplexityDescriptor | 3213.06 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1633 |
Xlogp | 0.618 |
ZagrebIndex | 168 |
TopoPSA | 104.06 |