Name | (3as,4r,9as)-4-(4-hydroxy-3,5-dimethoxyphenyl)-5,7-dimethoxy-2,2-dimethyl-3ah,4h,9h,9ah-naphtho[2,3-d][1,3]dioxol-6-ol |
Wikidata | Q104996542 |
Mol. formula | C23H28O8 |
CAS registry number | - |
Mol. weight | 432.4645 |
Temporary LOTUS id | LTS0064029 |
Name | (3as,4r,9as)-4-(4-hydroxy-3,5-dimethoxyphenyl)-5,7-dimethoxy-2,2-dimethyl-3ah,4h,9h,9ah-naphtho[2,3-d][1,3]dioxol-6-ol |
Canonical SMILES | COc1cc([C@@H]2c3c(cc(OC)c(O)c3OC)C[C@@H]3OC(C)(C)O[C@H]32)cc(OC)c1O |
2D SMILES | COc1cc(C2c3c(cc(OC)c(O)c3OC)CC3OC(C)(C)OC32)cc(OC)c1O |
IUPAC name | (3aS,4R,9aS)-4-(4-hydroxy-3,5-dimethoxyphenyl)-5,7-dimethoxy-2,2-dimethyl-2H,3aH,4H,9H,9aH-naphtho[2,3-d][1,3]dioxol-6-ol |
InChI | InChI=1S/C23H28O8/c1-23(2)30-16-10-12-9-15(28-5)20(25)22(29-6)18(12)17(21(16)31-23)11-7-13(26-3)19(24)14(8-11)27-4/h7-9,16-17,21,24-25H,10H2,1-6H3/t16-,17+,21+/m0/s1 |
InChIKey | FKECPAHWABPMES-CSODHUTKSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1COC2C1Cc3ccccc3C2c4ccccc4 |
Pathway | Superclass | Class |
Shikimates and Phenylpropanoids | Lignans | Arylnaphthalene and aryltetralin lignans |
Total atom number | 59 |
Heavy atom number | 31 |
Bond count | 34 |
Number of carbons | 23 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1 |
Alogp | 2.63 |
Alogp2 | 6.89 |
Apol | 65.5662 |
Bpol | 42.1058 |
EccentricConnectivityIndexDescriptor | 560 |
FmfDescriptor | 0.6129 |
Fsp3 | 0.4783 |
FragmentComplexityDescriptor | 2914.08 |
PetitjeanNumber | 0.4545 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2297 |
Xlogp | 2.492 |
ZagrebIndex | 172 |
TopoPSA | 95.84 |