Name | (2r,3r,3as,7s,7ar)-3-hydroxy-7,7a-dimethyl-4'-methylidene-hexahydro-1h-spiro[indene-2,3'-oxolan]-2'-one |
Wikidata | Q105225527 |
Mol. formula | C15H22O3 |
CAS registry number | - |
Mol. weight | 250.3339 |
Temporary LOTUS id | LTS0063403 |
Name | (2r,3r,3as,7s,7ar)-3-hydroxy-7,7a-dimethyl-4'-methylidene-hexahydro-1h-spiro[indene-2,3'-oxolan]-2'-one |
Canonical SMILES | C=C1COC(=O)[C@]12C[C@]1(C)[C@@H](C)CCC[C@@H]1[C@H]2O |
2D SMILES | C=C1COC(=O)C12CC1(C)C(C)CCCC1C2O |
IUPAC name | (1R,2R,3aR,4S,7aS)-1-hydroxy-3a,4-dimethyl-4'-methylidene-octahydrospiro[indene-2,3'-oxolan]-2'-one |
InChI | InChI=1S/C15H22O3/c1-9-5-4-6-11-12(16)15(8-14(9,11)3)10(2)7-18-13(15)17/h9,11-12,16H,2,4-8H2,1,3H3/t9-,11+,12+,14+,15+/m0/s1 |
InChIKey | QPPWVRIXJAAPPD-LTDFUNFTSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2(C1)CC3CCCCC3C2 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Fukinane sesquiterpenoids |
Total atom number | 40 |
Heavy atom number | 18 |
Bond count | 20 |
Number of carbons | 15 |
Minimal number of rings | 3 |
Maximal number of rings | 4 |
NP-likeness score | 1.1 |
Alogp | 2.36 |
Alogp2 | 5.55 |
Apol | 43.4754 |
Bpol | 26.9246 |
EccentricConnectivityIndexDescriptor | 195 |
FmfDescriptor | 0.7222 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 1458.03 |
PetitjeanNumber | 0.3333 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 492 |
Xlogp | 2.975 |
ZagrebIndex | 106 |
TopoPSA | 46.53 |