Name | 9-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-3ah,4h,5h,9ah,9bh-azuleno[4,5-b]furan-4-yl 2-(4-methoxyphenyl)acetate |
Wikidata | Q105337900 |
Mol. formula | C24H24O7 |
CAS registry number | - |
Mol. weight | 424.4441 |
Temporary LOTUS id | LTS0062984 |
Name | 9-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-3ah,4h,5h,9ah,9bh-azuleno[4,5-b]furan-4-yl 2-(4-methoxyphenyl)acetate |
Canonical SMILES | C=C1C(=O)OC2C3C(CO)=CC(=O)C3=C(C)CC(OC(=O)Cc3ccc(OC)cc3)C12 |
2D SMILES | C=C1C(=O)OC2C3C(CO)=CC(=O)C3=C(C)CC(OC(=O)Cc3ccc(OC)cc3)C12 |
IUPAC name | 9-(hydroxymethyl)-6-methyl-3-methylidene-2,7-dioxo-2H,3H,3aH,4H,5H,7H,9aH,9bH-azuleno[4,5-b]furan-4-yl 2-(4-methoxyphenyl)acetate |
InChI | InChI=1S/C24H24O7/c1-12-8-18(30-19(27)9-14-4-6-16(29-3)7-5-14)21-13(2)24(28)31-23(21)22-15(11-25)10-17(26)20(12)22/h4-7,10,18,21-23,25H,2,8-9,11H2,1,3H3 |
InChIKey | XOSKEJNNRKYHCC-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O(CCc1ccccc1)C2CC=C3CC=CC3C4OCCC24 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Guaiane sesquiterpenoids |
Total atom number | 55 |
Heavy atom number | 31 |
Bond count | 34 |
Number of carbons | 24 |
Minimal number of rings | 4 |
Maximal number of rings | 7 |
NP-likeness score | 1.01 |
Alogp | 2.39 |
Alogp2 | 5.71 |
Apol | 63.857 |
Bpol | 34.859 |
EccentricConnectivityIndexDescriptor | 779 |
FmfDescriptor | 0.7097 |
Fsp3 | 0.375 |
FragmentComplexityDescriptor | 2434.07 |
PetitjeanNumber | 0.4667 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 2639 |
Xlogp | 0.644 |
ZagrebIndex | 168 |
TopoPSA | 99.13 |