Name | 4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradec-9-en-3-yl 2-methylpropanoate |
Wikidata | Q104935728 |
Mol. formula | C19H26O5 |
CAS registry number | - |
Mol. weight | 334.4075 |
Temporary LOTUS id | LTS0060111 |
Name | 4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradec-9-en-3-yl 2-methylpropanoate |
Canonical SMILES | C=C1C(=O)OC2C=C(C)CCC3OC3(C)C(OC(=O)C(C)C)CC12 |
2D SMILES | C=C1C(=O)OC2C=C(C)CCC3OC3(C)C(OC(=O)C(C)C)CC12 |
IUPAC name | 4,9-dimethyl-14-methylidene-13-oxo-5,12-dioxatricyclo[9.3.0.0⁴,⁶]tetradec-9-en-3-yl 2-methylpropanoate |
InChI | InChI=1S/C19H26O5/c1-10(2)17(20)23-16-9-13-12(4)18(21)22-14(13)8-11(3)6-7-15-19(16,5)24-15/h8,10,13-16H,4,6-7,9H2,1-3,5H3 |
InChIKey | BGUBTIGWBFXLGY-UHFFFAOYSA-N |
Deep SMILES | could not be computed |
Murcko Framework | O1CCC2CCC3OC3CCC=CC12 |
Pathway | Superclass | Class |
Terpenoids | Sesquiterpenoids | Germacrane sesquiterpenoids |
Total atom number | 50 |
Heavy atom number | 24 |
Bond count | 26 |
Number of carbons | 19 |
Minimal number of rings | 3 |
Maximal number of rings | 6 |
NP-likeness score | 0.99 |
Alogp | 3.33 |
Alogp2 | 11.09 |
Apol | 54.7866 |
Bpol | 36.0874 |
EccentricConnectivityIndexDescriptor | 388 |
FmfDescriptor | 0.5833 |
Fsp3 | 0.6842 |
FragmentComplexityDescriptor | 2152.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1212 |
Xlogp | 2.338 |
ZagrebIndex | 132 |
TopoPSA | 65.13 |