Name | (2s,4ar,7r,8s)-8-[(3e)-5-hydroxy-3-methylpent-3-en-1-yl]-4,4,7,8-tetramethyl-2,3,4a,5,6,7-hexahydronaphthalen-2-ol |
Wikidata | Q105276144 |
Mol. formula | C20H34O2 |
CAS registry number | - |
Mol. weight | 306.4835 |
Temporary LOTUS id | LTS0059655 |
Name | (2s,4ar,7r,8s)-8-[(3e)-5-hydroxy-3-methylpent-3-en-1-yl]-4,4,7,8-tetramethyl-2,3,4a,5,6,7-hexahydronaphthalen-2-ol |
Canonical SMILES | C/C(=C\CO)CC[C@]1(C)C2=C[C@@H](O)CC(C)(C)[C@H]2CC[C@H]1C |
2D SMILES | CC(=CCO)CCC1(C)C2=CC(O)CC(C)(C)C2CCC1C |
IUPAC name | (2S,4aR,7R,8S)-8-[(3E)-5-hydroxy-3-methylpent-3-en-1-yl]-4,4,7,8-tetramethyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-2-ol |
InChI | InChI=1S/C20H34O2/c1-14(9-11-21)8-10-20(5)15(2)6-7-17-18(20)12-16(22)13-19(17,3)4/h9,12,15-17,21-22H,6-8,10-11,13H2,1-5H3/b14-9+/t15-,16-,17+,20+/m1/s1 |
InChIKey | UNUSYEIPWLMAPF-YDQHRQICSA-N |
Deep SMILES | could not be computed |
Murcko Framework | C1=C2CCCCC2CCC1 |
Pathway | Superclass | Class |
Terpenoids | Diterpenoids | Halimane diterpenoids |
Total atom number | 56 |
Heavy atom number | 22 |
Bond count | 23 |
Number of carbons | 20 |
Minimal number of rings | 2 |
Maximal number of rings | 3 |
NP-likeness score | 1 |
Alogp | 4.33 |
Alogp2 | 18.78 |
Apol | 59.475 |
Bpol | 37.169 |
EccentricConnectivityIndexDescriptor | 363 |
FmfDescriptor | 0.4545 |
Fsp3 | 0.8 |
FragmentComplexityDescriptor | 2787.02 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 1 |
WienerPathNumber | 995 |
Xlogp | 5.133 |
ZagrebIndex | 116 |
TopoPSA | 40.46 |