Name | Methyl (1r,4s,12r,13r,21s)-20-oxo-5,15-diazahexacyclo[11.5.2.1¹,¹².0⁴,¹².0⁶,¹¹.0¹⁵,²¹]henicosa-6,8,10-triene-4-carboxylate |
Wikidata | Q104986992 |
Mol. formula | C21H24N2O3 |
CAS registry number | - |
Mol. weight | 352.4277 |
Temporary LOTUS id | LTS0057279 |
Name | Methyl (1r,4s,12r,13r,21s)-20-oxo-5,15-diazahexacyclo[11.5.2.1¹,¹².0⁴,¹².0⁶,¹¹.0¹⁵,²¹]henicosa-6,8,10-triene-4-carboxylate |
Canonical SMILES | COC(=O)[C@]12CC[C@]34CCCN5C[C@H](C(=O)C3)[C@@]1(c1ccccc1N2)[C@@H]54 |
2D SMILES | COC(=O)C12CCC34CCCN5CC(C(=O)C3)C1(c1ccccc1N2)C54 |
IUPAC name | methyl (1R,4S,12R,13R,21S)-20-oxo-5,15-diazahexacyclo[11.5.2.1¹,¹².0⁴,¹².0⁶,¹¹.0¹⁵,²¹]henicosa-6,8,10-triene-4-carboxylate |
InChI | InChI=1S/C21H24N2O3/c1-26-18(25)20-9-8-19-7-4-10-23-12-14(16(24)11-19)21(20,17(19)23)13-5-2-3-6-15(13)22-20/h2-3,5-6,14,17,22H,4,7-12H2,1H3/t14-,17+,19-,20-,21+/m1/s1 |
InChIKey | DQJVZFCMYXOSQZ-FHBRLQHDSA-N |
Deep SMILES | could not be computed |
Murcko Framework | c1ccc2c(c1)NC3CCC45CCCN6CC(CC4)C23C65 |
Pathway | Superclass | Class |
Alkaloids | Tryptophan alkaloids | Aspidosperma type |
Total atom number | 50 |
Heavy atom number | 26 |
Bond count | 31 |
Number of carbons | 21 |
Minimal number of rings | 6 |
Maximal number of rings | 28 |
NP-likeness score | 1.11 |
Alogp | 1.53 |
Alogp2 | 2.35 |
Apol | 57.569 |
Bpol | 32.709 |
EccentricConnectivityIndexDescriptor | 373 |
FmfDescriptor | 0.8077 |
Fsp3 | 0.619 |
FragmentComplexityDescriptor | 2375.05 |
PetitjeanNumber | 0.5 |
LipinskiRuleOf5Failures | 0 |
WienerPathNumber | 1214 |
Xlogp | 0.846 |
ZagrebIndex | 166 |
TopoPSA | 58.64 |